Products 2488869-97-0
CAS 2488869-97-0 is the registry number for 1,1-Dimethylethyl N-[(1S)-1-methyl-4-oxo-4-(3,4,5-trifluorophenyl)butyl]carbamate, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
Tert-butyl N-[(2S)-5-oxo-5-(3,4,5-trifluorophenyl)pentan-2-yl]carbamate (CAS 2488869-97-0) is a chemical compound with the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. IUPAC name: tert-butyl N-[(2S)-5-oxo-5-(3,4,5-trifluorophenyl)pentan-2-yl]carbamate. InChIKey: ONHHHHGFAFATEZ-VIFPVBQESA-N.
| Molecular formula | C16H20F3NO3 |
|---|---|
| Molecular weight | 331.33 g/mol |
| IUPAC name | tert-butyl N-[(2S)-5-oxo-5-(3,4,5-trifluorophenyl)pentan-2-yl]carbamate |
| InChIKey | ONHHHHGFAFATEZ-VIFPVBQESA-N |
| SMILES | C[C@@H](CCC(=O)C1=CC(=C(C(=C1)F)F)F)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)