Products 2007915-52-6
CAS 2007915-52-6 is the registry number for tert-Butyl 2-(3-(trifluoromethyl)phenyl)morpholine-4-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl 2-[3-(trifluoromethyl)phenyl]morpholine-4-carboxylate (CAS 2007915-52-6) is a chemical compound with the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. IUPAC name: tert-butyl 2-[3-(trifluoromethyl)phenyl]morpholine-4-carboxylate. InChIKey: FRSZKQRYCQUFHM-UHFFFAOYSA-N.
| Molecular formula | C16H20F3NO3 |
|---|---|
| Molecular weight | 331.33 g/mol |
| IUPAC name | tert-butyl 2-[3-(trifluoromethyl)phenyl]morpholine-4-carboxylate |
| InChIKey | FRSZKQRYCQUFHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC(C1)C2=CC(=CC=C2)C(F)(F)F |
Computed by PubChem (NCBI)