Products 2488872-31-5
CAS 2488872-31-5 is the registry number for Carbonic anhydrase inhibitor 13. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(1-methyl-[1,3]thiazolo[3,2-a]benzimidazol-2-yl)-3-(4-sulfamoylphenyl)urea (CAS 2488872-31-5) is a chemical compound with the molecular formula C17H15N5O3S2 and a molecular weight of 401.5 g/mol. IUPAC name: 1-(1-methyl-[1,3]thiazolo[3,2-a]benzimidazol-2-yl)-3-(4-sulfamoylphenyl)urea. InChIKey: YURIRWNDJSOTFB-UHFFFAOYSA-N.
| Molecular formula | C17H15N5O3S2 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 1-(1-methyl-[1,3]thiazolo[3,2-a]benzimidazol-2-yl)-3-(4-sulfamoylphenyl)urea |
| InChIKey | YURIRWNDJSOTFB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NC3=CC=CC=C3N12)NC(=O)NC4=CC=C(C=C4)S(=O)(=O)N |
Computed by PubChem (NCBI)
Synonyms:
Carbonic anhydrase inhibitor 13, orb1688086