CAS 2488874-96-8 is the registry number for 3,4-Methylenedioxy-U-47700. Offered by: TRC. Available pack sizes: 100mg.
N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-methyl-1,3-benzodioxole-5-carboxamide (CAS 2488874-96-8) is a chemical compound with the molecular formula C17H24N2O3 and a molecular weight of 304.4 g/mol. IUPAC name: N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-methyl-1,3-benzodioxole-5-carboxamide. InChIKey: UUAVKYBZWVMWSM-ZIAGYGMSSA-N.
| Molecular formula | C17H24N2O3 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-methyl-1,3-benzodioxole-5-carboxamide |
| InChIKey | UUAVKYBZWVMWSM-ZIAGYGMSSA-N |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1N(C)C(=O)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)