CAS 2488925-45-5 is the registry number for tert-Butyl 4-amino-5-iodo-7H-pyrrolo[2,3-d]pyrimidine-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-amino-5-iodopyrrolo[2,3-d]pyrimidine-7-carboxylate (CAS 2488925-45-5) is a chemical compound with the molecular formula C11H13IN4O2 and a molecular weight of 360.15 g/mol. IUPAC name: tert-butyl 4-amino-5-iodopyrrolo[2,3-d]pyrimidine-7-carboxylate. InChIKey: KNDYQYLPDXZBFP-UHFFFAOYSA-N.
| Molecular formula | C11H13IN4O2 |
|---|---|
| Molecular weight | 360.15 g/mol |
| IUPAC name | tert-butyl 4-amino-5-iodopyrrolo[2,3-d]pyrimidine-7-carboxylate |
| InChIKey | KNDYQYLPDXZBFP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C(N=CN=C21)N)I |
Computed by PubChem (NCBI)