CAS 2489323-58-0 is the registry number for (2,3-Difluoro-4-methoxy-5-nitrophenyl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2,3-difluoro-4-methoxy-5-nitrophenyl)methanol (CAS 2489323-58-0) is a chemical compound with the molecular formula C8H7F2NO4 and a molecular weight of 219.14 g/mol. IUPAC name: (2,3-difluoro-4-methoxy-5-nitrophenyl)methanol. InChIKey: FAAMBLUKEZRUOP-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO4 |
|---|---|
| Molecular weight | 219.14 g/mol |
| IUPAC name | (2,3-difluoro-4-methoxy-5-nitrophenyl)methanol |
| InChIKey | FAAMBLUKEZRUOP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1F)F)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)