Products 248939-29-9
CAS 248939-29-9 is the registry number for Phenazostatin C. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 4-[1-(6-methoxycarbonylphenazin-1-yl)ethyl]phenazine-1-carboxylate (CAS 248939-29-9) is a chemical compound with the molecular formula C30H22N4O4 and a molecular weight of 502.5 g/mol. IUPAC name: methyl 4-[1-(6-methoxycarbonylphenazin-1-yl)ethyl]phenazine-1-carboxylate. InChIKey: LYBOZFUZRYGWHU-UHFFFAOYSA-N.
| Molecular formula | C30H22N4O4 |
|---|---|
| Molecular weight | 502.5 g/mol |
| IUPAC name | methyl 4-[1-(6-methoxycarbonylphenazin-1-yl)ethyl]phenazine-1-carboxylate |
| InChIKey | LYBOZFUZRYGWHU-UHFFFAOYSA-N |
| SMILES | CC(C1=C2C(=CC=C1)N=C3C(=N2)C=CC=C3C(=O)OC)C4=CC=C(C5=NC6=CC=CC=C6N=C45)C(=O)OC |
Computed by PubChem (NCBI)