Products 2489407-62-5
CAS 2489407-62-5 is the registry number for 1-(Benzyloxy)-5-bromo-3-fluoro-2-nitrobenzene, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1-fluoro-2-nitro-3-phenylmethoxybenzene (CAS 2489407-62-5) is a chemical compound with the molecular formula C13H9BrFNO3 and a molecular weight of 326.12 g/mol. IUPAC name: 5-bromo-1-fluoro-2-nitro-3-phenylmethoxybenzene. InChIKey: JYEMVKKUIDXRBQ-UHFFFAOYSA-N.
| Molecular formula | C13H9BrFNO3 |
|---|---|
| Molecular weight | 326.12 g/mol |
| IUPAC name | 5-bromo-1-fluoro-2-nitro-3-phenylmethoxybenzene |
| InChIKey | JYEMVKKUIDXRBQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C(=CC(=C2)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)