CAS 2489625-35-4 is the registry number for 1-(4-Chlorophenyl)-2-(2,4,5-trichlorophenyl)ethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
1-(4-chlorophenyl)-2-(2,4,5-trichlorophenyl)ethanone (CAS 2489625-35-4) is a chemical compound with the molecular formula C14H8Cl4O and a molecular weight of 334.0 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-(2,4,5-trichlorophenyl)ethanone. InChIKey: RJCCPZFYKVKFHH-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl4O |
|---|---|
| Molecular weight | 334.0 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-(2,4,5-trichlorophenyl)ethanone |
| InChIKey | RJCCPZFYKVKFHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC2=CC(=C(C=C2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)