CAS 1406438-94-5 is the registry number for 1-(2,4-Dichlorophenyl)-2-(3,4-dichlorophenyl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(2,4-dichlorophenyl)-2-(3,4-dichlorophenyl)ethanone (CAS 1406438-94-5) is a chemical compound with the molecular formula C14H8Cl4O and a molecular weight of 334.0 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-2-(3,4-dichlorophenyl)ethanone. InChIKey: LKSDNMBLUNNMGR-UHFFFAOYSA-N.
| Molecular formula | C14H8Cl4O |
|---|---|
| Molecular weight | 334.0 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-2-(3,4-dichlorophenyl)ethanone |
| InChIKey | LKSDNMBLUNNMGR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)C2=C(C=C(C=C2)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)