CAS 2489838-11-9 is the registry number for (R)-1-Benzyl-6-(((tert-butyldimethylsilyl)oxy)methyl)piperidin-2-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(6R)-1-benzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-2-one (CAS 2489838-11-9) is a chemical compound with the molecular formula C19H31NO2Si and a molecular weight of 333.5 g/mol. IUPAC name: (6R)-1-benzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-2-one. InChIKey: DMBZNEUAEQRSIQ-QGZVFWFLSA-N.
| Molecular formula | C19H31NO2Si |
|---|---|
| Molecular weight | 333.5 g/mol |
| IUPAC name | (6R)-1-benzyl-6-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-2-one |
| InChIKey | DMBZNEUAEQRSIQ-QGZVFWFLSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CCCC(=O)N1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)