Products 2490404-03-8

CAS 2490404-03-8 is the registry number for Ethyl 2-(2,5-dichlorothiazol-4-yl)-2,2-difluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-(2,5-dichloro-1,3-thiazol-4-yl)-2,2-difluoroacetate (CAS 2490404-03-8) is a chemical compound with the molecular formula C7H5Cl2F2NO2S and a molecular weight of 276.09 g/mol. IUPAC name: ethyl 2-(2,5-dichloro-1,3-thiazol-4-yl)-2,2-difluoroacetate. InChIKey: PIXVJBYQNIDMEL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Cl2F2NO2S
Molecular weight276.09 g/mol
IUPAC nameethyl 2-(2,5-dichloro-1,3-thiazol-4-yl)-2,2-difluoroacetate
InChIKeyPIXVJBYQNIDMEL-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=C(SC(=N1)Cl)Cl)(F)F

Computed by PubChem (NCBI)