Products 2490418-66-9

CAS 2490418-66-9 is the registry number for 3,3,4,4,4-pentafluorobutan-1-amine hydrochloride, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

3,3,4,4,4-pentafluorobutan-1-amine;hydrochloride (CAS 2490418-66-9) is a chemical compound with the molecular formula C4H7ClF5N and a molecular weight of 199.55 g/mol. IUPAC name: 3,3,4,4,4-pentafluorobutan-1-amine;hydrochloride. InChIKey: NXYZYINMWSFIDA-UHFFFAOYSA-N.

Identity
Molecular formulaC4H7ClF5N
Molecular weight199.55 g/mol
IUPAC name3,3,4,4,4-pentafluorobutan-1-amine;hydrochloride
InChIKeyNXYZYINMWSFIDA-UHFFFAOYSA-N
SMILESC(CN)C(C(F)(F)F)(F)F.Cl

Computed by PubChem (NCBI)