Products 2490538-26-4
CAS 2490538-26-4 is the registry number for Apoptotic agent-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-4-(4-nitrophenyl)-3H-pyrimido[4,5-d]pyrimidine-2-thione (CAS 2490538-26-4) is a chemical compound with the molecular formula C12H6ClN5O2S and a molecular weight of 319.73 g/mol. IUPAC name: 5-chloro-4-(4-nitrophenyl)-3H-pyrimido[4,5-d]pyrimidine-2-thione. InChIKey: YMOPNBMWCWYNCS-UHFFFAOYSA-N.
| Molecular formula | C12H6ClN5O2S |
|---|---|
| Molecular weight | 319.73 g/mol |
| IUPAC name | 5-chloro-4-(4-nitrophenyl)-3H-pyrimido[4,5-d]pyrimidine-2-thione |
| InChIKey | YMOPNBMWCWYNCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C3C(=NC(=S)N2)N=CN=C3Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Apoptotic agent-1, orb1689181