Products 2490666-05-0
CAS 2490666-05-0 is the registry number for 2-(2-Methoxyethoxy)-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
2-(2-methoxyethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 2490666-05-0) is a chemical compound with the molecular formula C16H22BNO4 and a molecular weight of 303.2 g/mol. IUPAC name: 2-(2-methoxyethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: CTTJISBSQNPWBP-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO4 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 2-(2-methoxyethoxy)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | CTTJISBSQNPWBP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C#N)OCCOC |
Computed by PubChem (NCBI)