CAS 2490666-17-4 is the registry number for N-(Pentan-3-yl)-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
N-pentan-3-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 2490666-17-4) is a chemical compound with the molecular formula C16H27BN2O2 and a molecular weight of 290.2 g/mol. IUPAC name: N-pentan-3-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: RTGNACSWIOZLAH-UHFFFAOYSA-N.
| Molecular formula | C16H27BN2O2 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | N-pentan-3-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | RTGNACSWIOZLAH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)NC(CC)CC |
Computed by PubChem (NCBI)