CAS 2490672-92-7 appears in our catalog under these names: TDO-IN-1, 98%, TDO-IN-1/ 99.86% (existing batch purity), TDO–IN–1, TDO-IN-1 99%, TDO-IN-1. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 2mg, 10mg, 25mg, 50mg, 100mg, 100 mg.
N-[(4-methyl-2-nitrophenyl)methyl]-6-(trifluoromethyl)-1H-indazol-4-amine (CAS 2490672-92-7) is a chemical compound with the molecular formula C16H13F3N4O2 and a molecular weight of 350.29 g/mol. IUPAC name: N-[(4-methyl-2-nitrophenyl)methyl]-6-(trifluoromethyl)-1H-indazol-4-amine. InChIKey: FIFXIQQUXZVXNB-UHFFFAOYSA-N.
| Molecular formula | C16H13F3N4O2 |
|---|---|
| Molecular weight | 350.29 g/mol |
| IUPAC name | N-[(4-methyl-2-nitrophenyl)methyl]-6-(trifluoromethyl)-1H-indazol-4-amine |
| InChIKey | FIFXIQQUXZVXNB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CNC2=CC(=CC3=C2C=NN3)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)