CAS 2490698-20-7 appears in our catalog under these names: 4-fluoro-1H-spiro[2???,1-benzothiazole-3,4'-piperidine]-2,2-dione hydrochloride, 95%, 4-Fluoro-1H-spiro(benzo(c)isothiazole-3,4'-piperidine) 2,2-dioxide hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
4-fluorospiro[1H-2,1-benzothiazole-3,4'-piperidine] 2,2-dioxide;hydrochloride (CAS 2490698-20-7) is a chemical compound with the molecular formula C11H14ClFN2O2S and a molecular weight of 292.76 g/mol. IUPAC name: 4-fluorospiro[1H-2,1-benzothiazole-3,4'-piperidine] 2,2-dioxide;hydrochloride. InChIKey: FRMBRXOTXUMLDZ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClFN2O2S |
|---|---|
| Molecular weight | 292.76 g/mol |
| IUPAC name | 4-fluorospiro[1H-2,1-benzothiazole-3,4'-piperidine] 2,2-dioxide;hydrochloride |
| InChIKey | FRMBRXOTXUMLDZ-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=CC=C3F)NS2(=O)=O.Cl |
Computed by PubChem (NCBI)