CAS 2492-26-4 appears in our catalog under these names: Sodium mercaptobenzothiazole, 98%, Sodium 2–Mercaptobenzothiazole, Sodium 2-mercaptobenzothiazole - 50% aqueous solution, Sodium 2-Mercaptobenzothiazole, >97.0%(HPLC), 2(3H)-Benzothiazolethione,sodium salt (1:1), 50% in water, 50% in water. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 100g, 1g, 500g, 5g, 25g, 250g, 1000g.
Sodium 1,3-benzothiazole-2-thiolate (CAS 2492-26-4) is a chemical compound with the molecular formula C7H4NNaS2 and a molecular weight of 189.2 g/mol. IUPAC name: sodium 1,3-benzothiazole-2-thiolate. InChIKey: VLDHWMAJBNWALQ-UHFFFAOYSA-M.
| Molecular formula | C7H4NNaS2 |
|---|---|
| Molecular weight | 189.2 g/mol |
| IUPAC name | sodium 1,3-benzothiazole-2-thiolate |
| InChIKey | VLDHWMAJBNWALQ-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)N=C(S2)[S-].[Na+] |
Computed by PubChem (NCBI)