CAS 24930-02-7 appears in our catalog under these names: Trimethylsilyl 2,2,3,3,3-pentafluoropropanoate, 95%, Trimethylsilyl pentafluoropropionate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 1g.
Trimethylsilyl 2,2,3,3,3-pentafluoropropanoate (CAS 24930-02-7) is a chemical compound with the molecular formula C6H9F5O2Si and a molecular weight of 236.21 g/mol. IUPAC name: trimethylsilyl 2,2,3,3,3-pentafluoropropanoate. InChIKey: ISUNIRMVMASACA-UHFFFAOYSA-N.
| Molecular formula | C6H9F5O2Si |
|---|---|
| Molecular weight | 236.21 g/mol |
| IUPAC name | trimethylsilyl 2,2,3,3,3-pentafluoropropanoate |
| InChIKey | ISUNIRMVMASACA-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=O)C(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)