Products 2493298-68-1
CAS 2493298-68-1 is the registry number for Topoisomerase II inhibitor 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
S-(4-oxo-5H-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl) furan-2-carbothioate (CAS 2493298-68-1) is a chemical compound with the molecular formula C14H8N4O3S and a molecular weight of 312.31 g/mol. IUPAC name: S-(4-oxo-5H-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl) furan-2-carbothioate. InChIKey: OUCNSEMVYGJKCQ-UHFFFAOYSA-N.
| Molecular formula | C14H8N4O3S |
|---|---|
| Molecular weight | 312.31 g/mol |
| IUPAC name | S-(4-oxo-5H-[1,2,4]triazolo[4,3-a]quinoxalin-1-yl) furan-2-carbothioate |
| InChIKey | OUCNSEMVYGJKCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)C3=NN=C(N23)SC(=O)C4=CC=CO4 |
Computed by PubChem (NCBI)
Synonyms:
Topoisomerase II inhibitor 8, orb1689249