CAS 2494-56-6 appears in our catalog under these names: Butyrylcholine iodide, 95%, Butyrylcholine Iodide, Butyrylcholine iodide, Butyrylcholine iodide, min. 95 %, 5 g, Butyrylcholine iodide, min. 95 %, 10 g. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 5g, 25g, 1g, 100g, 10g, 50g, 200mg, 250 mg.
2-butanoyloxyethyl(trimethyl)azanium iodide (CAS 2494-56-6) is a chemical compound with the molecular formula C9H20INO2 and a molecular weight of 301.17 g/mol. IUPAC name: 2-butanoyloxyethyl(trimethyl)azanium iodide. InChIKey: GALNBQVDMJRFGJ-UHFFFAOYSA-M.
| Molecular formula | C9H20INO2 |
|---|---|
| Molecular weight | 301.17 g/mol |
| IUPAC name | 2-butanoyloxyethyl(trimethyl)azanium iodide |
| InChIKey | GALNBQVDMJRFGJ-UHFFFAOYSA-M |
| SMILES | CCCC(=O)OCC[N+](C)(C)C.[I-] |
Computed by PubChem (NCBI)