Products 2494276-55-8
CAS 2494276-55-8 is the registry number for Antiparasitic agent-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-chloro-1-ethyl-3-hydroxy-3-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethenyl]indol-2-one (CAS 2494276-55-8) is a chemical compound with the molecular formula C20H16ClN3O3 and a molecular weight of 381.8 g/mol. IUPAC name: 5-chloro-1-ethyl-3-hydroxy-3-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethenyl]indol-2-one. InChIKey: WIYAKYWRWNNLES-UHFFFAOYSA-N.
| Molecular formula | C20H16ClN3O3 |
|---|---|
| Molecular weight | 381.8 g/mol |
| IUPAC name | 5-chloro-1-ethyl-3-hydroxy-3-[1-(3-phenyl-1,2,4-oxadiazol-5-yl)ethenyl]indol-2-one |
| InChIKey | WIYAKYWRWNNLES-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)Cl)C(C1=O)(C(=C)C3=NC(=NO3)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)
Synonyms:
Antiparasitic agent-5, orb1688395