CAS 24948-17-2 appears in our catalog under these names: Atracurium besilate EP Impurity F Iodide, rac-N-Methyl-Laudanosine Iodide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 750mg.
1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium iodide (CAS 24948-17-2) is a chemical compound with the molecular formula C22H30INO4 and a molecular weight of 499.4 g/mol. IUPAC name: 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium iodide. InChIKey: SANXPMGEBDLSJX-UHFFFAOYSA-M.
| Molecular formula | C22H30INO4 |
|---|---|
| Molecular weight | 499.4 g/mol |
| IUPAC name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium iodide |
| InChIKey | SANXPMGEBDLSJX-UHFFFAOYSA-M |
| SMILES | C[N+]1(CCC2=CC(=C(C=C2C1CC3=CC(=C(C=C3)OC)OC)OC)OC)C.[I-] |
Computed by PubChem (NCBI)