Products 2495-79-6

CAS 2495-79-6 is the registry number for 4-Benzyloxy-3-methoxy-6-nitrophenylpyruvic Acid. Offered by: TRC. Available pack sizes: 1g, 250mg, 500mg.

Structural formula: {0} (CAS {1})

3-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)-2-oxopropanoic acid (CAS 2495-79-6) is a chemical compound with the molecular formula C17H15NO7 and a molecular weight of 345.30 g/mol. IUPAC name: 3-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)-2-oxopropanoic acid. InChIKey: WVMOIIQOERAKJA-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15NO7
Molecular weight345.30 g/mol
IUPAC name3-(5-methoxy-2-nitro-4-phenylmethoxyphenyl)-2-oxopropanoic acid
InChIKeyWVMOIIQOERAKJA-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)CC(=O)C(=O)O)[N+](=O)[O-])OCC2=CC=CC=C2

Computed by PubChem (NCBI)