CAS 2495443-56-4 is the registry number for (3S,7S)-7-Methyl-2,3,4,7-tetrahydro-1H-azepin-3-amine bis(2,2,2-trifluoroacetate), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,7S)-7-methyl-2,3,4,7-tetrahydro-1H-azepin-3-amine;bis(2,2,2-trifluoroacetic acid) (CAS 2495443-56-4) is a chemical compound with the molecular formula C11H16F6N2O4 and a molecular weight of 354.25 g/mol. IUPAC name: (3S,7S)-7-methyl-2,3,4,7-tetrahydro-1H-azepin-3-amine;bis(2,2,2-trifluoroacetic acid). InChIKey: KASWJUUBKQMGGZ-JFYKYWLVSA-N.
| Molecular formula | C11H16F6N2O4 |
|---|---|
| Molecular weight | 354.25 g/mol |
| IUPAC name | (3S,7S)-7-methyl-2,3,4,7-tetrahydro-1H-azepin-3-amine;bis(2,2,2-trifluoroacetic acid) |
| InChIKey | KASWJUUBKQMGGZ-JFYKYWLVSA-N |
| SMILES | C[C@H]1C=CC[C@@H](CN1)N.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)