CAS 2007924-92-5 appears in our catalog under these names: 8-Methyl-3,8-diazabicyclo[4.2.0]octane bis(trifluoroacetic acid), 95%, 8-methyl-3,8-diazabicyclo(4.2.0)octane, bis(trifluoroacetic acid), 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
8-methyl-3,8-diazabicyclo[4.2.0]octane;bis(2,2,2-trifluoroacetic acid) (CAS 2007924-92-5) is a chemical compound with the molecular formula C11H16F6N2O4 and a molecular weight of 354.25 g/mol. IUPAC name: 8-methyl-3,8-diazabicyclo[4.2.0]octane;bis(2,2,2-trifluoroacetic acid). InChIKey: DYJPMQAVAUHGMI-UHFFFAOYSA-N.
| Molecular formula | C11H16F6N2O4 |
|---|---|
| Molecular weight | 354.25 g/mol |
| IUPAC name | 8-methyl-3,8-diazabicyclo[4.2.0]octane;bis(2,2,2-trifluoroacetic acid) |
| InChIKey | DYJPMQAVAUHGMI-UHFFFAOYSA-N |
| SMILES | CN1CC2C1CNCC2.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)