CAS 249566-79-8 is the registry number for 3,4-Di-O-acetyl-2-deoxy-2-fluoro-L-fucopyranose. Offered by: Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg.
[(2S,3R,4R,5S)-4-acetyloxy-5-fluoro-2-hydroxy-6-oxohexan-3-yl] acetate (CAS 249566-79-8) is a chemical compound with the molecular formula C10H15FO6 and a molecular weight of 250.22 g/mol. IUPAC name: [(2S,3R,4R,5S)-4-acetyloxy-5-fluoro-2-hydroxy-6-oxohexan-3-yl] acetate. InChIKey: WHYYIDNXDKSPNW-MPSSQSJQSA-N.
| Molecular formula | C10H15FO6 |
|---|---|
| Molecular weight | 250.22 g/mol |
| IUPAC name | [(2S,3R,4R,5S)-4-acetyloxy-5-fluoro-2-hydroxy-6-oxohexan-3-yl] acetate |
| InChIKey | WHYYIDNXDKSPNW-MPSSQSJQSA-N |
| SMILES | C[C@@H]([C@H]([C@H]([C@@H](C=O)F)OC(=O)C)OC(=O)C)O |
Computed by PubChem (NCBI)