Products 249622-60-4
CAS 249622-60-4 appears in our catalog under these names: Ropinirole EP Impurity B, Ropinirole Impurity 2（Ropinirole EP Impurity B）, N-Desbispropyl-N-pentyl-2-methyl Ropinirole, >95% (HPLC), N-Desbispropyl-N-pentyl-2-methyl ropinirole, Ropinirole impurity 11. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 2mg.
4-[2-(2-methylpentylamino)ethyl]-1,3-dihydroindol-2-one (CAS 249622-60-4) is a chemical compound with the molecular formula C16H24N2O and a molecular weight of 260.37 g/mol. IUPAC name: 4-[2-(2-methylpentylamino)ethyl]-1,3-dihydroindol-2-one. InChIKey: LOJFKUSLBCTPHV-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O |
|---|---|
| Molecular weight | 260.37 g/mol |
| IUPAC name | 4-[2-(2-methylpentylamino)ethyl]-1,3-dihydroindol-2-one |
| InChIKey | LOJFKUSLBCTPHV-UHFFFAOYSA-N |
| SMILES | CCCC(C)CNCCC1=C2CC(=O)NC2=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
N-Desbispropyl-N-pentyl-2-methyl Ropinirole, Ropinirole EP Impurity B, 4-[2-(2-methylpentylamino)ethyl]-1,3-dihydroindol-2-one, Ropinirole hydrochloride impurity B [EP], 2H-Indol-2-one, 1,3-dihydro-4-(2-((2-methylpentyl)amino)ethyl), 4-(2-((2-Methylpentyl)amino)ethyl)-1,3-dihydro-2H-indol-2-one, 4-(2-((2-methylpentyl)amino)ethyl)indolin-2-one, ROPINIROLE HYDROCHLORIDE IMPURITY B [EP IMPURITY]