CAS 249636-68-8 is the registry number for (5-Bromobenzo[d][1,3]dioxol-4-yl)trimethylsilane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(5-bromo-1,3-benzodioxol-4-yl)-trimethylsilane (CAS 249636-68-8) is a chemical compound with the molecular formula C10H13BrO2Si and a molecular weight of 273.20 g/mol. IUPAC name: (5-bromo-1,3-benzodioxol-4-yl)-trimethylsilane. InChIKey: HMPCJYJTRJWFOJ-UHFFFAOYSA-N.
| Molecular formula | C10H13BrO2Si |
|---|---|
| Molecular weight | 273.20 g/mol |
| IUPAC name | (5-bromo-1,3-benzodioxol-4-yl)-trimethylsilane |
| InChIKey | HMPCJYJTRJWFOJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C(C=CC2=C1OCO2)Br |
Computed by PubChem (NCBI)