CAS 24964-91-8 appears in our catalog under these names: Tris(4–bromophenyl)ammoniumyl hexachloroantimonate, TRIS(4-BROMOPHENYL)AMINIUM HEXACHLOROANT, TRIS(4-BROMOPHENYL)AMINIUM HEXACHLORO-AN. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 1g, 250mg, 5G.
Hexachloroantimony(1-);tris(4-bromophenyl)azanium (CAS 24964-91-8) is a chemical compound with the molecular formula C18H13Br3Cl6NSb and a molecular weight of 817.5 g/mol. IUPAC name: hexachloroantimony(1-);tris(4-bromophenyl)azanium. InChIKey: BHLIYPVGDLIKBB-UHFFFAOYSA-I.
| Molecular formula | C18H13Br3Cl6NSb |
|---|---|
| Molecular weight | 817.5 g/mol |
| IUPAC name | hexachloroantimony(1-);tris(4-bromophenyl)azanium |
| InChIKey | BHLIYPVGDLIKBB-UHFFFAOYSA-I |
| SMILES | C1=CC(=CC=C1[NH+](C2=CC=C(C=C2)Br)C3=CC=C(C=C3)Br)Br.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl |
Computed by PubChem (NCBI)