Products 24966-91-4

CAS 24966-91-4 is the registry number for 4-(4-Methylphenyl)-1,3-thiazol-2-amine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

4-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide (CAS 24966-91-4) is a chemical compound with the molecular formula C10H11BrN2S and a molecular weight of 271.18 g/mol. IUPAC name: 4-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide. InChIKey: RYGLGFKXSWZERM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrN2S
Molecular weight271.18 g/mol
IUPAC name4-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide
InChIKeyRYGLGFKXSWZERM-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)C2=CSC(=N2)N.Br

Computed by PubChem (NCBI)