CAS 24966-91-4 is the registry number for 4-(4-Methylphenyl)-1,3-thiazol-2-amine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.
4-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide (CAS 24966-91-4) is a chemical compound with the molecular formula C10H11BrN2S and a molecular weight of 271.18 g/mol. IUPAC name: 4-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide. InChIKey: RYGLGFKXSWZERM-UHFFFAOYSA-N.
| Molecular formula | C10H11BrN2S |
|---|---|
| Molecular weight | 271.18 g/mol |
| IUPAC name | 4-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide |
| InChIKey | RYGLGFKXSWZERM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=N2)N.Br |
Computed by PubChem (NCBI)