CAS 2497-06-5 appears in our catalog under these names: Disulfoton Sulfone, Disulfoton-sulfone, DISULFOTON-SULFONE PESTANAL, 100MG, Disulfoton-sulfone, Concentration: 100 µg/ml Solvent: Toluene, Disulfoton-sulfone, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, Dr. Ehrenstorfer, TRC, Sigma-Aldrich, HPC Standards. Available pack sizes: on request, 50mg, 2,5g, 100MG, 1x1ml, 1x5ml.
Diethoxy-(2-ethylsulfonylethylsulfanyl)-sulfanylidene-lambda5-phosphane (CAS 2497-06-5) is a chemical compound with the molecular formula C8H19O4PS3 and a molecular weight of 306.4 g/mol. IUPAC name: diethoxy-(2-ethylsulfonylethylsulfanyl)-sulfanylidene-lambda5-phosphane. InChIKey: BKVJOVPVLOJPKJ-UHFFFAOYSA-N.
| Molecular formula | C8H19O4PS3 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | diethoxy-(2-ethylsulfonylethylsulfanyl)-sulfanylidene-lambda5-phosphane |
| InChIKey | BKVJOVPVLOJPKJ-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(OCC)SCCS(=O)(=O)CC |
Computed by PubChem (NCBI)