Products 2497504-81-9
CAS 2497504-81-9 is the registry number for hCAIX-IN-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[[4-[[4-(chloromethyl)-2-oxochromen-7-yl]oxymethyl]triazol-1-yl]methyl]benzonitrile (CAS 2497504-81-9) is a chemical compound with the molecular formula C21H15ClN4O3 and a molecular weight of 406.8 g/mol. IUPAC name: 4-[[4-[[4-(chloromethyl)-2-oxochromen-7-yl]oxymethyl]triazol-1-yl]methyl]benzonitrile. InChIKey: ZIIJQDPLFHHGPA-UHFFFAOYSA-N.
| Molecular formula | C21H15ClN4O3 |
|---|---|
| Molecular weight | 406.8 g/mol |
| IUPAC name | 4-[[4-[[4-(chloromethyl)-2-oxochromen-7-yl]oxymethyl]triazol-1-yl]methyl]benzonitrile |
| InChIKey | ZIIJQDPLFHHGPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(N=N2)COC3=CC4=C(C=C3)C(=CC(=O)O4)CCl)C#N |
Computed by PubChem (NCBI)
Synonyms:
hCAIX-IN-11, orb1688012