Products 2497504-86-4
CAS 2497504-86-4 is the registry number for hCAXII-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(chloromethyl)-7-[[1-[(4-methoxyphenyl)methyl]triazol-4-yl]methoxy]chromen-2-one (CAS 2497504-86-4) is a chemical compound with the molecular formula C21H18ClN3O4 and a molecular weight of 411.8 g/mol. IUPAC name: 4-(chloromethyl)-7-[[1-[(4-methoxyphenyl)methyl]triazol-4-yl]methoxy]chromen-2-one. InChIKey: TZSJUXLIUSWVQX-UHFFFAOYSA-N.
| Molecular formula | C21H18ClN3O4 |
|---|---|
| Molecular weight | 411.8 g/mol |
| IUPAC name | 4-(chloromethyl)-7-[[1-[(4-methoxyphenyl)methyl]triazol-4-yl]methoxy]chromen-2-one |
| InChIKey | TZSJUXLIUSWVQX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C=C(N=N2)COC3=CC4=C(C=C3)C(=CC(=O)O4)CCl |
Computed by PubChem (NCBI)
Synonyms:
hCAXII-IN-2, orb1687937