Products 2497525-96-7
CAS 2497525-96-7 appears in our catalog under these names: IAMA-6, 99.65%, ARN23746, 98%, 3-(N,N-Dimethylsulfamoyl)-4-((8,8,8-trifluorooctyl)amino)benzoic acid, 98%. Offered by: MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 10 mg, 10mM/1mL, 100 mg, 25 mg, 50 mg, 5 mg, 1mg, 5mg.
3-(dimethylsulfamoyl)-4-(8,8,8-trifluorooctylamino)benzoic acid (CAS 2497525-96-7) is a chemical compound with the molecular formula C17H25F3N2O4S and a molecular weight of 410.5 g/mol. IUPAC name: 3-(dimethylsulfamoyl)-4-(8,8,8-trifluorooctylamino)benzoic acid. InChIKey: ZAJDYPRGNPKHEI-UHFFFAOYSA-N.
| Molecular formula | C17H25F3N2O4S |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | 3-(dimethylsulfamoyl)-4-(8,8,8-trifluorooctylamino)benzoic acid |
| InChIKey | ZAJDYPRGNPKHEI-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=CC(=C1)C(=O)O)NCCCCCCCC(F)(F)F |
Computed by PubChem (NCBI)