CAS 2497586-47-5 appears in our catalog under these names: 7-[diethoxyphosphoryl(difluoro)methyl]naphthalene-2-carboxylic acid, 95%, 7-((Diethoxyphosphoryl)difluoromethyl)-2-naphthoic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg.
7-[diethoxyphosphoryl(difluoro)methyl]naphthalene-2-carboxylic acid (CAS 2497586-47-5) is a chemical compound with the molecular formula C16H17F2O5P and a molecular weight of 358.27 g/mol. IUPAC name: 7-[diethoxyphosphoryl(difluoro)methyl]naphthalene-2-carboxylic acid. InChIKey: LYMMAPXGDQBXRR-UHFFFAOYSA-N.
| Molecular formula | C16H17F2O5P |
|---|---|
| Molecular weight | 358.27 g/mol |
| IUPAC name | 7-[diethoxyphosphoryl(difluoro)methyl]naphthalene-2-carboxylic acid |
| InChIKey | LYMMAPXGDQBXRR-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C(C1=CC2=C(C=CC(=C2)C(=O)O)C=C1)(F)F)OCC |
Computed by PubChem (NCBI)