CAS 2498-27-3 appears in our catalog under these names: 3-Hydroxyphenyltrimethylammonium Iodide, >95% (HPLC), 3-Hydroxy-N,N,N-trimethylbenzenaminium iodide, 98%, Neostigmine EP Impurity A Iodide, Neostigmine impurity A. Offered by: TRC, Chemat Brand. Available pack sizes: 10g, 1g, on request.
(3-hydroxyphenyl)-trimethylazanium iodide (CAS 2498-27-3) is a chemical compound with the molecular formula C9H14INO and a molecular weight of 279.12 g/mol. IUPAC name: (3-hydroxyphenyl)-trimethylazanium iodide. InChIKey: KNPHMCQIKGHPRU-UHFFFAOYSA-N.
| Molecular formula | C9H14INO |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | (3-hydroxyphenyl)-trimethylazanium iodide |
| InChIKey | KNPHMCQIKGHPRU-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C1=CC(=CC=C1)O.[I-] |
Computed by PubChem (NCBI)