CAS 249938-52-1 is the registry number for Kaempferol 7-glucuronide. Offered by: TRC. Available pack sizes: 100mg.
Kaempferol 7-O-glucuronide is a kaempferol O-glucuronide that is kaempferol with a beta-D-glucosiduronic acid residue attached at the 7-position. It has a role as a metabolite. It is a trihydroxyflavone and a kaempferol O-glucuronide.
Source: ChEBI
| Molecular formula | C21H18O12 |
|---|---|
| Molecular weight | 462.4 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-[3,5-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChIKey | HKMMHEQNCQNUNN-JENRNSKYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)C(=O)O)O)O)O)O)O)O |
Computed by PubChem (NCBI)