Products 2499489-76-6
CAS 2499489-76-6 is the registry number for Carpro-AM1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(6-chloro-9H-carbazol-2-yl)-N-(3-methyl-2-pyridinyl)propanamide (CAS 2499489-76-6) is a chemical compound with the molecular formula C21H18ClN3O and a molecular weight of 363.8 g/mol. IUPAC name: 2-(6-chloro-9H-carbazol-2-yl)-N-(3-methyl-2-pyridinyl)propanamide. InChIKey: MPEOMWUCLSYMAA-UHFFFAOYSA-N.
| Molecular formula | C21H18ClN3O |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | 2-(6-chloro-9H-carbazol-2-yl)-N-(3-methyl-2-pyridinyl)propanamide |
| InChIKey | MPEOMWUCLSYMAA-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)NC(=O)C(C)C2=CC3=C(C=C2)C4=C(N3)C=CC(=C4)Cl |
Computed by PubChem (NCBI)
Synonyms:
Carpro-AM1, orb1688657