Products 24999-51-7
CAS 24999-51-7 is the registry number for (3-Bromo-phenyl)-oxo-acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
3-bromobenzoyl cyanide (CAS 24999-51-7) is a chemical compound with the molecular formula C8H4BrNO and a molecular weight of 210.03 g/mol. IUPAC name: 3-bromobenzoyl cyanide. InChIKey: ZYKLXMMQMSIZBZ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO |
|---|---|
| Molecular weight | 210.03 g/mol |
| IUPAC name | 3-bromobenzoyl cyanide |
| InChIKey | ZYKLXMMQMSIZBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C#N |
Computed by PubChem (NCBI)