CAS 25018-15-9 is the registry number for 6-O-Hydroxyethyl-D-glucose. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 1000mg, 500mg.
(2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-(2-hydroxyethoxy)hexanal (CAS 25018-15-9) is a chemical compound with the molecular formula C8H16O7 and a molecular weight of 224.21 g/mol. IUPAC name: (2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-(2-hydroxyethoxy)hexanal. InChIKey: QQNRRUQBWHITJY-LXGUWJNJSA-N.
| Molecular formula | C8H16O7 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-(2-hydroxyethoxy)hexanal |
| InChIKey | QQNRRUQBWHITJY-LXGUWJNJSA-N |
| SMILES | C(COC[C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)O |
Computed by PubChem (NCBI)