Products 25020-13-7
CAS 25020-13-7 is the registry number for Fructose-histidine, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
(2S)-3-(1H-imidazol-5-yl)-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]propanoic acid (CAS 25020-13-7) is a chemical compound with the molecular formula C12H19N3O7 and a molecular weight of 317.30 g/mol. IUPAC name: (2S)-3-(1H-imidazol-5-yl)-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]propanoic acid. InChIKey: GSVIFAPVCHKNHF-AYHFEMFVSA-N.
| Molecular formula | C12H19N3O7 |
|---|---|
| Molecular weight | 317.30 g/mol |
| IUPAC name | (2S)-3-(1H-imidazol-5-yl)-2-[[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]amino]propanoic acid |
| InChIKey | GSVIFAPVCHKNHF-AYHFEMFVSA-N |
| SMILES | C1=C(NC=N1)C[C@@H](C(=O)O)NCC(=O)[C@H]([C@@H]([C@@H](CO)O)O)O |
Computed by PubChem (NCBI)