Products 2502189-47-9

CAS 2502189-47-9 is the registry number for E3 Ligase Ligand-linker Conjugate 157. Offered by: MedChemExpress. Available pack sizes: 50 mg, 10 mg, 100 mg, 25 mg, 5 mg.

Structural formula: {0} (CAS {1})

3-(3-methyl-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl)piperidine-2,6-dione (CAS 2502189-47-9) is a chemical compound with the molecular formula C18H22N4O3 and a molecular weight of 342.4 g/mol. IUPAC name: 3-(3-methyl-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl)piperidine-2,6-dione. InChIKey: FJMWWLNEKGHSNO-UHFFFAOYSA-N.

Identity
Molecular formulaC18H22N4O3
Molecular weight342.4 g/mol
IUPAC name3-(3-methyl-2-oxo-5-piperidin-4-ylbenzimidazol-1-yl)piperidine-2,6-dione
InChIKeyFJMWWLNEKGHSNO-UHFFFAOYSA-N
SMILESCN1C2=C(C=CC(=C2)C3CCNCC3)N(C1=O)C4CCC(=O)NC4=O

Computed by PubChem (NCBI)