CAS 2502300-24-3 is the registry number for 2-(tert-Butoxycarbonyl)benzo[b]thiophene-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-methylpropan-2-yl)oxycarbonyl]-1-benzothiophene-5-carboxylic acid (CAS 2502300-24-3) is a chemical compound with the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]-1-benzothiophene-5-carboxylic acid. InChIKey: OHGITFWFBPLKNG-UHFFFAOYSA-N.
| Molecular formula | C14H14O4S |
|---|---|
| Molecular weight | 278.33 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]-1-benzothiophene-5-carboxylic acid |
| InChIKey | OHGITFWFBPLKNG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC2=C(S1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)