CAS 25027-85-4 is the registry number for 2-((4-Chlorobutyl)methylamino)-N-(2,6-dimethylphenyl)acetamide Hydrochloride. Offered by: TRC. Available pack sizes: 250mg.
4-chlorobutyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-methylazanium chloride (CAS 25027-85-4) is a chemical compound with the molecular formula C15H24Cl2N2O and a molecular weight of 319.3 g/mol. IUPAC name: 4-chlorobutyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-methylazanium chloride. InChIKey: NBESRSJZEXDBNU-UHFFFAOYSA-N.
| Molecular formula | C15H24Cl2N2O |
|---|---|
| Molecular weight | 319.3 g/mol |
| IUPAC name | 4-chlorobutyl-[2-(2,6-dimethylanilino)-2-oxoethyl]-methylazanium chloride |
| InChIKey | NBESRSJZEXDBNU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)C[NH+](C)CCCCCl.[Cl-] |
Computed by PubChem (NCBI)