CAS 2503203-92-5 is the registry number for 2-Chloro-6-ethynylnaphthalene, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
2-chloro-6-ethynylnaphthalene (CAS 2503203-92-5) is a chemical compound with the molecular formula C12H7Cl and a molecular weight of 186.63 g/mol. IUPAC name: 2-chloro-6-ethynylnaphthalene. InChIKey: XXHCDQUXBIMZML-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl |
|---|---|
| Molecular weight | 186.63 g/mol |
| IUPAC name | 2-chloro-6-ethynylnaphthalene |
| InChIKey | XXHCDQUXBIMZML-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(C=C1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)