CAS 2503205-09-0 is the registry number for 6-Chloro-5-(trifluoromethyl)pyrazin-2-amine, 98%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-5-(trifluoromethyl)pyrazin-2-amine (CAS 2503205-09-0) is a chemical compound with the molecular formula C5H3ClF3N3 and a molecular weight of 197.54 g/mol. IUPAC name: 6-chloro-5-(trifluoromethyl)pyrazin-2-amine. InChIKey: AREBWQWMVIMNEK-UHFFFAOYSA-N.
| Molecular formula | C5H3ClF3N3 |
|---|---|
| Molecular weight | 197.54 g/mol |
| IUPAC name | 6-chloro-5-(trifluoromethyl)pyrazin-2-amine |
| InChIKey | AREBWQWMVIMNEK-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)C(F)(F)F)Cl)N |
Computed by PubChem (NCBI)