Products 2503209-25-2

CAS 2503209-25-2 appears in our catalog under these names: 3-Chloroazetidine-1-sulfonyl chloride, 98%, 3-chloroazetidine-1-sulfonyl chloride, 97%, 97%, 3-chloroazetidine-1-sulfonyl chloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 10g.

Structural formula: {0} (CAS {1})

3-chloroazetidine-1-sulfonyl chloride (CAS 2503209-25-2) is a chemical compound with the molecular formula C3H5Cl2NO2S and a molecular weight of 190.05 g/mol. IUPAC name: 3-chloroazetidine-1-sulfonyl chloride. InChIKey: ULQPPUVOWAYYBR-UHFFFAOYSA-N.

Identity
Molecular formulaC3H5Cl2NO2S
Molecular weight190.05 g/mol
IUPAC name3-chloroazetidine-1-sulfonyl chloride
InChIKeyULQPPUVOWAYYBR-UHFFFAOYSA-N
SMILESC1C(CN1S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)