CAS 250375-03-2 appears in our catalog under these names: Boc-Pen(NPys)-OH, Boc-Pen (NPys)-OH, Boc–Pen(NPys)–OH. Offered by: Creative Peptides, TRC, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 50mg, 2g.
(2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3-nitro-2-pyridinyl)disulfanyl]butanoic acid (CAS 250375-03-2) is a chemical compound with the molecular formula C15H21N3O6S2 and a molecular weight of 403.5 g/mol. IUPAC name: (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3-nitro-2-pyridinyl)disulfanyl]butanoic acid. InChIKey: KBMFCGVAENSRSY-SNVBAGLBSA-N.
| Molecular formula | C15H21N3O6S2 |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[(3-nitro-2-pyridinyl)disulfanyl]butanoic acid |
| InChIKey | KBMFCGVAENSRSY-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)C(C)(C)SSC1=C(C=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)